1,3-Indandione, 2-(3,4-dimethoxy-2-hydroxyphenyl)-2-hydroxy- structure
|
Common Name | 1,3-Indandione, 2-(3,4-dimethoxy-2-hydroxyphenyl)-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 75840-17-4 | Molecular Weight | 314.28900 | |
| Density | 1.444g/cm3 | Boiling Point | 554.2ºC at 760 mmHg | |
| Molecular Formula | C17H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.7ºC | |
| Name | 2-hydroxy-2-(2-hydroxy-3,4-dimethoxyphenyl)indene-1,3-dione |
|---|
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 554.2ºC at 760 mmHg |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.28900 |
| Flash Point | 207.7ºC |
| Exact Mass | 314.07900 |
| PSA | 93.06000 |
| LogP | 1.67620 |
| Index of Refraction | 1.655 |
| InChIKey | PPDNDRVXNUNXQU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(O)C(=O)c3ccccc3C2=O)c(O)c1OC |
| HS Code | 2914509090 |
|---|
|
~75%
1,3-Indandione,... CAS#:75840-17-4 |
| Literature: Poupelin; Saint-Ruf; Perche; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 253 - 262 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |