5-(4-methylphenyl)sulfonylfuran-2-carbonitrile
Modify Date: 2025-09-06 19:22:32
5-(4-methylphenyl)sulfonylfuran-2-carbonitrile structure
|
Common Name | 5-(4-methylphenyl)sulfonylfuran-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 75745-88-9 | Molecular Weight | 247.27000 | |
| Density | 1.38g/cm3 | Boiling Point | 431.5ºC at 760 mmHg | |
| Molecular Formula | C12H9NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.8ºC | |
| Name | 5-(4-methylphenyl)sulfonylfuran-2-carbonitrile |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 431.5ºC at 760 mmHg |
| Molecular Formula | C12H9NO3S |
| Molecular Weight | 247.27000 |
| Flash Point | 214.8ºC |
| Exact Mass | 247.03000 |
| PSA | 79.45000 |
| LogP | 3.37328 |
| Index of Refraction | 1.612 |
| InChIKey | MNTSMTCDKVHWBG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C#N)o2)cc1 |
|
~98%
5-(4-methylphen... CAS#:75745-88-9 |
| Literature: Pavlov Chemistry of Heterocyclic Compounds, 2002 , vol. 38, # 5 p. 524 - 529 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![2-[5-(4-methylphenyl)sulfonylfuran-2-yl]-4,5-dihydro-1H-imidazole structure](https://image.chemsrc.com/caspic/137/75745-81-2.png)
CAS#:75745-81-2