5-((4-Chlorophenyl)sulfonyl)-2-furancarbonitrile
Modify Date: 2025-11-11 18:10:43
5-((4-Chlorophenyl)sulfonyl)-2-furancarbonitrile structure
|
Common Name | 5-((4-Chlorophenyl)sulfonyl)-2-furancarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 75745-61-8 | Molecular Weight | 267.68800 | |
| Density | 1.54g/cm3 | Boiling Point | 448.5ºC at 760 mmHg | |
| Molecular Formula | C11H6ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 5-(4-chlorophenyl)sulfonylfuran-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760 mmHg |
| Molecular Formula | C11H6ClNO3S |
| Molecular Weight | 267.68800 |
| Flash Point | 225.1ºC |
| Exact Mass | 266.97600 |
| PSA | 79.45000 |
| LogP | 3.71828 |
| Index of Refraction | 1.636 |
| InChIKey | OUDYWPWCRBPOMZ-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)o1 |
|
~87%
5-((4-Chlorophe... CAS#:75745-61-8 |
| Literature: Shridhar, D. R.; Jogibhukta, M.; Reddy, P. Gopal; Krishnan, V. S. H. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 5 p. 386 - 388 |
| 5-<(4-chlorophenyl)sulphonyl>-2-furancarbonitrile |
| 2-Furancarbonitrile,5-((4-chlorophenyl)sulfonyl) |
| 5-((4-Chlorophenyl)sulfonyl)-2-furancarbonitrile |