2-Imidazolidinone, 4-((3-(cyclopentyloxy)-4-methoxyphenyl)methyl)- structure
|
Common Name | 2-Imidazolidinone, 4-((3-(cyclopentyloxy)-4-methoxyphenyl)methyl)- | ||
|---|---|---|---|---|
| CAS Number | 75614-09-4 | Molecular Weight | 290.35700 | |
| Density | 1.169g/cm3 | Boiling Point | 514.6ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265ºC | |
Use of 2-Imidazolidinone, 4-((3-(cyclopentyloxy)-4-methoxyphenyl)methyl)-GYKI-13380 is an appetite suppressant. GYKI-13380 has the potential for the research of neurology diseases[1]. |
| Name | 4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]imidazolidin-2-one |
|---|
| Description | GYKI-13380 is an appetite suppressant. GYKI-13380 has the potential for the research of neurology diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 514.6ºC at 760 mmHg |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.35700 |
| Flash Point | 265ºC |
| Exact Mass | 290.16300 |
| PSA | 63.08000 |
| LogP | 2.20930 |
| Index of Refraction | 1.554 |
| InChIKey | YOFWLAASFMHLAD-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2CNC(=O)N2)cc1OC1CCCC1 |