2-Thiazolidineacetic acid, 2-methyl-alpha-2-propenyl-, ethyl ester structure
|
Common Name | 2-Thiazolidineacetic acid, 2-methyl-alpha-2-propenyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 75606-53-0 | Molecular Weight | 229.33900 | |
| Density | 1.045g/cm3 | Boiling Point | 301.6ºC at 760 mmHg | |
| Molecular Formula | C11H19NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.2ºC | |
| Name | ethyl 2-(2-methyl-1,3-thiazolidin-2-yl)pent-4-enoate |
|---|
| Density | 1.045g/cm3 |
|---|---|
| Boiling Point | 301.6ºC at 760 mmHg |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.33900 |
| Flash Point | 136.2ºC |
| Exact Mass | 229.11400 |
| PSA | 63.63000 |
| LogP | 2.12320 |
| Index of Refraction | 1.493 |
| InChIKey | LNWIIIHSXUAKPI-UHFFFAOYSA-N |
| SMILES | C=CCC(C(=O)OCC)C1(C)NCCS1 |
|
~50%
2-Thiazolidinea... CAS#:75606-53-0 |
| Literature: Mesnard; Miginiac; Fatome; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 247 - 252 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |