2-(phenylamino)acridin-9(10H)-one structure
|
Common Name | 2-(phenylamino)acridin-9(10H)-one | ||
|---|---|---|---|---|
| CAS Number | 75512-00-4 | Molecular Weight | 286.32700 | |
| Density | 1.274g/cm3 | Boiling Point | 490.3ºC at 760 mmHg | |
| Molecular Formula | C19H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.4ºC | |
| Name | 2-anilino-10H-acridin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 490.3ºC at 760 mmHg |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.32700 |
| Flash Point | 186.4ºC |
| Exact Mass | 286.11100 |
| PSA | 44.89000 |
| LogP | 4.49790 |
| Index of Refraction | 1.698 |
| InChIKey | USTNFRALPDIXCN-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]c2ccc(Nc3ccccc3)cc12 |
|
~92%
2-(phenylamino)... CAS#:75512-00-4 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4258190 A1, 1981 ; |
|
~86%
2-(phenylamino)... CAS#:75512-00-4 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4258190 A1, 1981 ; |
|
~%
2-(phenylamino)... CAS#:75512-00-4 |
| Literature: Kalb Chemische Berichte, 1910 , vol. 43, p. 2212 |
|
~%
2-(phenylamino)... CAS#:75512-00-4 |
| Literature: Kalb Chemische Berichte, 1910 , vol. 43, p. 2212 |
|
~%
2-(phenylamino)... CAS#:75512-00-4 |
| Literature: Kalb Chemische Berichte, 1910 , vol. 43, p. 2212 |
| 2-Anilino-10H-acridin-9-on |
| 2-anilinoacridone |
| EINECS 278-231-3 |