4-nitro-1-(phenylthio)acridin-9(10H)-one structure
|
Common Name | 4-nitro-1-(phenylthio)acridin-9(10H)-one | ||
|---|---|---|---|---|
| CAS Number | 21810-29-7 | Molecular Weight | 348.37500 | |
| Density | 1.47g/cm3 | Boiling Point | 549.2ºC at 760mmHg | |
| Molecular Formula | C19H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9ºC | |
| Name | 4-nitro-1-phenylsulfanyl-10H-acridin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 549.2ºC at 760mmHg |
| Molecular Formula | C19H12N2O3S |
| Molecular Weight | 348.37500 |
| Flash Point | 285.9ºC |
| Exact Mass | 348.05700 |
| PSA | 103.98000 |
| LogP | 5.26390 |
| Vapour Pressure | 4.13E-12mmHg at 25°C |
| Index of Refraction | 1.753 |
| InChIKey | GXVKCZFAZONQGQ-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]c2c([N+](=O)[O-])ccc(Sc3ccccc3)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 244-587-3 |
| 1-Phenylthio-4-nitroacridon |