1-(2-Methyl-3-nitrophenyl)ethanone structure
|
Common Name | 1-(2-Methyl-3-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 75473-11-9 | Molecular Weight | 179.17300 | |
| Density | 1.201 | Boiling Point | 250ºC | |
| Molecular Formula | C9H9NO3 | Melting Point | 53-55ºC | |
| MSDS | N/A | Flash Point | 103ºC | |
| Name | 1-(2-Methyl-3-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201 |
|---|---|
| Boiling Point | 250ºC |
| Melting Point | 53-55ºC |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17300 |
| Flash Point | 103ºC |
| Exact Mass | 179.05800 |
| PSA | 62.89000 |
| LogP | 2.62900 |
| Index of Refraction | 1.552 |
| InChIKey | HPQVXLJSJCOYFE-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc([N+](=O)[O-])c1C |
| HS Code | 2914700090 |
|---|
|
~66%
1-(2-Methyl-3-n... CAS#:75473-11-9 |
| Literature: Warner-Lambert Company Patent: US5017604 A1, 1991 ; US 5017604 A |
|
~%
1-(2-Methyl-3-n... CAS#:75473-11-9 |
| Literature: Binder; Hromatka; Noe; Hillebrand; Veit; Blum Archiv der Pharmazie, 1980 , vol. 313, # 7 p. 587 - 602 |
|
~%
1-(2-Methyl-3-n... CAS#:75473-11-9 |
| Literature: Binder; Hromatka; Noe; Hillebrand; Veit; Blum Archiv der Pharmazie, 1980 , vol. 313, # 7 p. 587 - 602 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Methyl-3-nitrobenzophenon |
| 2-Methyl-3-nitro-acetophenon |