2'-hydroxy-5'-methyl-3'-nitroacetophenone
Modify Date: 2025-08-25 15:44:42
2'-hydroxy-5'-methyl-3'-nitroacetophenone structure
|
Common Name | 2'-hydroxy-5'-methyl-3'-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 66108-30-3 | Molecular Weight | 195.17200 | |
| Density | 1.323g/cm3 | Boiling Point | 254ºC at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | 133-136 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 106ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Hydroxy-5-methyl-3-nitroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 254ºC at 760 mmHg |
| Melting Point | 133-136 °C(lit.) |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 106ºC |
| Exact Mass | 195.05300 |
| PSA | 83.12000 |
| LogP | 2.33460 |
| Index of Refraction | 1.586 |
| InChIKey | XSHQMMIEZHWNAK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(C)cc([N+](=O)[O-])c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
|
~87%
2'-hydroxy-5'-m... CAS#:66108-30-3 |
| Literature: Synthesis, , # 11 p. 940 - 942 |
|
~%
2'-hydroxy-5'-m... CAS#:66108-30-3 |
| Literature: Synthesis, , # 11 p. 940 - 942 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Densities and ultrasonic speed of 2-hydroxy-5-methyl-3-nitro acetophenone in N,N-dimethylformamide at different temperatures. Aswar AS and Choudhary DS.
Bull. Chem. Soc. Ethiop. 27(1) , 155-160., (2012)
|
|
|
Aromatic solvent effect on the rotational isomerism in 2-hydroxy-5-methyl-3-nitroacetophenone. Konopacka A, et al.
J. Phys. Org. Chem. 18(12) , 1190-95, (2005)
|
| 1-(2-hydroxy-5-methyl-3-nitrophenyl)ethanone |
| MFCD00192216 |