1,2,4,5-Tetrathiane-3,3,6,6-tetracarboxamide,N,N',N'',N'''-tetraphenyl- structure
|
Common Name | 1,2,4,5-Tetrathiane-3,3,6,6-tetracarboxamide,N,N',N'',N'''-tetraphenyl- | ||
|---|---|---|---|---|
| CAS Number | 75435-34-6 | Molecular Weight | 632.79600 | |
| Density | 1.522g/cm3 | Boiling Point | 1033.5ºC at 760mmHg | |
| Molecular Formula | C30H24N4O4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 578.8ºC | |
| Name | N3,N'3,N6,N'6-tetraphenyl-1,2,4,5-tetrathiane-3,3,6,6-tetracarboxamide |
|---|
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 1033.5ºC at 760mmHg |
| Molecular Formula | C30H24N4O4S4 |
| Molecular Weight | 632.79600 |
| Flash Point | 578.8ºC |
| Exact Mass | 632.06800 |
| PSA | 217.60000 |
| LogP | 7.00220 |
| Index of Refraction | 1.794 |
| InChIKey | LGNYZJVTBODFDH-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)C1(C(=O)Nc2ccccc2)SSC(C(=O)Nc2ccccc2)(C(=O)Nc2ccccc2)SS1 |
|
~84%
1,2,4,5-Tetrath... CAS#:75435-34-6 |
| Literature: Kutney, Gerald W.; Still, Ian W.J. Canadian Journal of Chemistry, 1980 , vol. 58, p. 1233 - 1238 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |