Bis(2-carbopentyloxy-3,5,6-trichlorophenyl) oxalate structure
|
Common Name | Bis(2-carbopentyloxy-3,5,6-trichlorophenyl) oxalate | ||
|---|---|---|---|---|
| CAS Number | 75203-51-9 | Molecular Weight | 677.182 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 692.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H24Cl6O8 | Melting Point | 76-80ºC | |
| MSDS | Chinese USA | Flash Point | 202.4±30.5 °C | |
| Name | Bis(3,5,6-trichloro-2-n-pentyloxycarbonylphenyl) oxalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 692.1±55.0 °C at 760 mmHg |
| Melting Point | 76-80ºC |
| Molecular Formula | C26H24Cl6O8 |
| Molecular Weight | 677.182 |
| Flash Point | 202.4±30.5 °C |
| Exact Mass | 673.960205 |
| PSA | 105.20000 |
| LogP | 10.41 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | PURKHUDOTFUVNG-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)c1c(Cl)cc(Cl)c(Cl)c1OC(=O)C(=O)Oc1c(Cl)c(Cl)cc(Cl)c1C(=O)OCCCCC |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 29182900 |
| EINECS 278-124-1 |
| Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate |
| Bis(2,3,5-trichloro-6-((pentyloxy)carbonyl)phenyl) oxalate |
| bis(2,3,5-trichloro-6-pentoxycarbonylphenyl) oxalate |
| Ethanedioic acid, bis[2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl] ester |
| MFCD00012038 |