Benzenesulfonamide,4-amino-N-(5-chloro-4,6-dimethyl-2-pyrimidinyl)-
Modify Date: 2025-09-05 15:18:46
Benzenesulfonamide,4-amino-N-(5-chloro-4,6-dimethyl-2-pyrimidinyl)- structure
|
Common Name | Benzenesulfonamide,4-amino-N-(5-chloro-4,6-dimethyl-2-pyrimidinyl)- | ||
|---|---|---|---|---|
| CAS Number | 7510-86-3 | Molecular Weight | 312.77500 | |
| Density | 1.476g/cm3 | Boiling Point | 551.5ºC at 760 mmHg | |
| Molecular Formula | C12H13ClN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.3ºC | |
| Name | 4-amino-N-(5-chloro-4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|
| Density | 1.476g/cm3 |
|---|---|
| Boiling Point | 551.5ºC at 760 mmHg |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.77500 |
| Flash Point | 287.3ºC |
| Exact Mass | 312.04500 |
| PSA | 106.35000 |
| LogP | 3.86480 |
| Index of Refraction | 1.649 |
| InChIKey | MOIYTEVLGSSSOC-UHFFFAOYSA-N |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(N)cc2)nc(C)c1Cl |
|
~%
Benzenesulfonam... CAS#:7510-86-3 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1602,1603 |
|
~%
Benzenesulfonam... CAS#:7510-86-3 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1602,1603 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |