methyl 2-benzamidobenzoate structure
|
Common Name | methyl 2-benzamidobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7510-49-8 | Molecular Weight | 255.26900 | |
| Density | 1.237g/cm3 | Boiling Point | 324.3ºC at 760 mmHg | |
| Molecular Formula | C15H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150ºC | |
| Name | methyl 2-benzamidobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 324.3ºC at 760 mmHg |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.26900 |
| Flash Point | 150ºC |
| Exact Mass | 255.09000 |
| PSA | 55.40000 |
| LogP | 2.79850 |
| Index of Refraction | 1.621 |
| InChIKey | NOMUELNZAGGIDL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzoyl-anthranilic acid methyl ester |
| 2-benzoylamino-benzoic acid methyl ester |
| N-Benzoyl-anthranilsaeure-methylester |
| 4-methoxy-1H-2,1-benzothiazine 2,2-dioxide |