4-(benzenesulfonyloxy)benzoic acid
4-(benzenesulfonyloxy)benzoic acid structure
|
Common Name | 4-(benzenesulfonyloxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 7507-41-7 | Molecular Weight | 278.28100 | |
| Density | 1.422g/cm3 | Boiling Point | 488.7ºC at 760 mmHg | |
| Molecular Formula | C13H10O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.3ºC | |
| Name | 4-(benzenesulfonyloxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 488.7ºC at 760 mmHg |
| Molecular Formula | C13H10O5S |
| Molecular Weight | 278.28100 |
| Flash Point | 249.3ºC |
| Exact Mass | 278.02500 |
| PSA | 89.05000 |
| LogP | 3.23330 |
| Index of Refraction | 1.615 |
| InChIKey | ORTHAADHPFWMEZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
|
~90%
4-(benzenesulfo... CAS#:7507-41-7 |
| Literature: Hexal AG Patent: EP2314581 A1, 2011 ; Location in patent: Page/Page column 34 ; |
|
~95%
4-(benzenesulfo... CAS#:7507-41-7 |
| Literature: HEXAL AKTIENGESELLSCHAFT; SCHICKANEDER, Christian; SCHAeFER, Juergen Patent: WO2011/47877 A1, 2011 ; Location in patent: Page/Page column 45-46 ; |
|
~%
4-(benzenesulfo... CAS#:7507-41-7 |
| Literature: Hexal AG Patent: EP2314581 A1, 2011 ; |
|
~%
4-(benzenesulfo... CAS#:7507-41-7 |
| Literature: Hexal AG Patent: EP2314581 A1, 2011 ; |
|
~%
4-(benzenesulfo... CAS#:7507-41-7 |
| Literature: Morrison Journal of the American Chemical Society, 1952 , vol. 74, p. 3431 |
|
~%
4-(benzenesulfo... CAS#:7507-41-7 |
| Literature: Bad.Anilin u. Sodaf. Patent: DE162322 ; |
CAS#:82640-04-8
CAS#:84541-36-6
CAS#:84541-38-8| 4-Benzolsulfonyloxy-benzoesaeure |
| 4-benzenesulfonyloxybenzoic acid |