1(3H)-Isobenzofuranone,3-[[5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-3-phenyl- structure
|
Common Name | 1(3H)-Isobenzofuranone,3-[[5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 7499-46-9 | Molecular Weight | 364.47700 | |
| Density | 1.13g/cm3 | Boiling Point | 503.6ºC at 760 mmHg | |
| Molecular Formula | C24H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
| Name | 3-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-phenyl-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 503.6ºC at 760 mmHg |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.47700 |
| Flash Point | 218.1ºC |
| Exact Mass | 364.20400 |
| PSA | 35.53000 |
| LogP | 5.53550 |
| Index of Refraction | 1.579 |
| InChIKey | IRVNXTZDUTXMJY-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C)C)C(OC2(c3ccccc3)OC(=O)c3ccccc32)C1 |
|
~%
1(3H)-Isobenzof... CAS#:7499-46-9 |
| Literature: Schaefgen; Verhoek; Newman Journal of the American Chemical Society, 1945 , vol. 67, p. 253,254 Show Details Bonner Journal of the American Chemical Society, 1963 , vol. 85, p. 439 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 3-p-menthan-3-yloxy-3-phenyl-phthalide |