2-Benzoylbenzoic acid structure
|
Common Name | 2-Benzoylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 85-52-9 | Molecular Weight | 226.227 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 436.4±28.0 °C at 760 mmHg | |
| Molecular Formula | C14H10O3 | Melting Point | 126-129 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 231.9±20.5 °C | |
| Name | 2-Benzoylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.4±28.0 °C at 760 mmHg |
| Melting Point | 126-129 °C(lit.) |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.227 |
| Flash Point | 231.9±20.5 °C |
| Exact Mass | 226.062988 |
| PSA | 54.37000 |
| LogP | 2.31 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | FGTYTUFKXYPTML-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | DG3600000 |
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Photosensitizing properties of compounds related to benzophenone.
Acta Derm. Venereol. 93(1) , 30-2, (2013) Benzophenone is a phototoxic compound with absorption maxima in the ultraviolet A (UVA) and ultraviolet B (UVB) range. Many benzophenone derivatives are known to be photosensitizing. On the other hand... |
|
|
Mass spectrometric behavior of phenolic acids standards and their analysis in the plant samples with LC/ESI/MS system.
J. Chromatogr. B. Analyt. Technol. Biomed. Life Sci. 967 , 21-7, (2014) Liquid chromatography coupled to mass spectrometry (MS) with electrospray ionization (ESI) is one of analytical techniques to obtain accurate results of low molecular weight aromatic compounds in biol... |
|
|
Nonsteroidal anti-inflammatory drugs and their analogues as inhibitors of aldo-keto reductase AKR1C3: new lead compounds for the development of anticancer agents.
Bioorg. Med. Chem. Lett. 15 , 5170-5, (2005) Nonsteroidal anti-inflammatory drugs (NSAIDs) like indomethacin, flufenamic acid, and related compounds have been recently identified as potent inhibitors of AKR1C3. We report that some other NSAIDs (... |
| ortho-benzoyl benzoic acid |
| o-Benzoyl Benzoic Acid |
| 2-benzoyl benzoic acid |
| benzoylbenzoic acid |
| o-benzoyl-benzoicaci |
| carboxybenzophenone |
| RARECHEM AL BO 1426 |
| 1-carboxy-2-phenylcarbonylbenzene |
| MFCD00002472 |
| OBBA |
| EINECS 201-612-2 |
| Benzoic acid, 2-benzoyl- |
| O-BENZOYLBENZOIC ACID |
| 2-CARBOXYBENZOPHENONE |
| 2-benzoyl-benzoicaci |
| 2-Benzoylbenzoic acid |
| skp10a |