1-dimethylaminobut-3-en-2-yl 2,2-diphenylacetate structure
|
Common Name | 1-dimethylaminobut-3-en-2-yl 2,2-diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 7495-17-2 | Molecular Weight | 309.40200 | |
| Density | 1.062g/cm3 | Boiling Point | 419.1ºC at 760 mmHg | |
| Molecular Formula | C20H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.2ºC | |
| Name | 1-(dimethylamino)but-3-en-2-yl 2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 419.1ºC at 760 mmHg |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.40200 |
| Flash Point | 133.2ºC |
| Exact Mass | 309.17300 |
| PSA | 29.54000 |
| LogP | 3.47790 |
| Index of Refraction | 1.552 |
| InChIKey | NBLAPEQEHJNDOZ-UHFFFAOYSA-N |
| SMILES | C=CC(CN(C)C)OC(=O)C(c1ccccc1)c1ccccc1 |
|
~%
1-dimethylamino... CAS#:7495-17-2 |
| Literature: Blicke; Biel Journal of the American Chemical Society, 1957 , vol. 79, p. 5508,5511 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| diphenyl-acetic acid-(1-dimethylaminomethyl-allyl ester) |
| Diphenyl-essigsaeure-(1-dimethylaminomethyl-allylester) |