2-Ethoxy-3-Bromo-5-Nitropyridine
Modify Date: 2025-08-26 11:51:20
2-Ethoxy-3-Bromo-5-Nitropyridine structure
|
Common Name | 2-Ethoxy-3-Bromo-5-Nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 74919-31-6 | Molecular Weight | 247.04600 | |
| Density | 1.634g/cm3 | Boiling Point | 298.603ºC at 760 mmHg | |
| Molecular Formula | C7H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.39ºC | |
| Name | 3-Bromo-2-ethoxy-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.634g/cm3 |
|---|---|
| Boiling Point | 298.603ºC at 760 mmHg |
| Molecular Formula | C7H7BrN2O3 |
| Molecular Weight | 247.04600 |
| Flash Point | 134.39ºC |
| Exact Mass | 245.96400 |
| PSA | 67.94000 |
| LogP | 2.67420 |
| Index of Refraction | 1.574 |
| InChIKey | DWFSXOCGFPCFBC-UHFFFAOYSA-N |
| SMILES | CCOc1ncc([N+](=O)[O-])cc1Br |
| HS Code | 2933399090 |
|---|
|
~%
2-Ethoxy-3-Brom... CAS#:74919-31-6 |
| Literature: Recueil: Journal of the Royal Netherlands Chemical Society, , vol. 99, # 3 p. 83 - 86 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-bromo-2-ethoxy-5-nitro-pyridine |
| 3-Brom-2-ethoxy-5-nitro-pyridin |
| Pyridine,3-bromo-2-ethoxy-5-nitro |
| 3-bromanyl-2-ethoxy-5-nitro-pyridine |