3-Methylquinoline-8-sulfonyl chloride structure
|
Common Name | 3-Methylquinoline-8-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 74863-82-4 | Molecular Weight | 241.694 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 371.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H8ClNO2S | Melting Point | 158-159ºC | |
| MSDS | N/A | Flash Point | 178.5±23.7 °C | |
| Name | 3-Methylquinoline-8-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.5±27.0 °C at 760 mmHg |
| Melting Point | 158-159ºC |
| Molecular Formula | C10H8ClNO2S |
| Molecular Weight | 241.694 |
| Flash Point | 178.5±23.7 °C |
| Exact Mass | 240.996429 |
| PSA | 55.41000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | XCMAYGDQKTWICK-UHFFFAOYSA-N |
| SMILES | Cc1cnc2c(S(=O)(=O)Cl)cccc2c1 |
| Storage condition | -20°C Freezer |
| Stability | Moisture Sensitive - Store Under Inert Atmosphere |
|
~18%
3-Methylquinoli... CAS#:74863-82-4 |
| Literature: 3-Dimensional Pharmaceuticals, Inc. Patent: US6235778 B1, 2001 ; US 6235778 B1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methyl-8-quinolinesulfonyl chloride |
| 3-methylquinoline-8-sulfonyl chloride |
| 8-Quinolinesulfonyl chloride, 3-methyl- |
| MFCD02683367 |