5,6-dichloro-1H-imidazo[4,5-b]pyrazine-2-carboxylic acid structure
|
Common Name | 5,6-dichloro-1H-imidazo[4,5-b]pyrazine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 74840-07-6 | Molecular Weight | 233.01200 | |
| Density | 1.975g/cm3 | Boiling Point | 478.5ºC at 760 mmHg | |
| Molecular Formula | C6H2Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | 5,6-dichloro-1H-imidazo[4,5-b]pyrazine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.975g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760 mmHg |
| Molecular Formula | C6H2Cl2N4O2 |
| Molecular Weight | 233.01200 |
| Flash Point | 243.2ºC |
| Exact Mass | 231.95500 |
| PSA | 91.76000 |
| LogP | 1.35790 |
| Index of Refraction | 1.78 |
| InChIKey | YXRXEPZMAPZYMM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc2nc(Cl)c(Cl)nc2[nH]1 |
|
~85%
5,6-dichloro-1H... CAS#:74840-07-6 |
| Literature: Tong, Y. C. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 381 - 382 |
|
~%
5,6-dichloro-1H... CAS#:74840-07-6 |
| Literature: Tong, Y. C. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 381 - 382 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,6-dichloro-1H-imidazo<4,5-b>pyrazine-2-carboxylic acid |
| HMS2886P24 |