ethyl 3,4-dichloro-2,5,7,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraene-8-carboxylate structure
|
Common Name | ethyl 3,4-dichloro-2,5,7,9-tetrazabicyclo[4.3.0]nona-2,4,7,10-tetraene-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 74840-06-5 | Molecular Weight | 261.06500 | |
| Density | 1.633g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C8H6Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | ethyl 5,6-dichloro-1H-imidazo[4,5-b]pyrazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.633g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Molecular Formula | C8H6Cl2N4O2 |
| Molecular Weight | 261.06500 |
| Flash Point | 190.3ºC |
| Exact Mass | 259.98700 |
| PSA | 80.76000 |
| LogP | 1.83640 |
| Index of Refraction | 1.659 |
| InChIKey | RVVTZGVECQIZTE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc2nc(Cl)c(Cl)nc2[nH]1 |
|
~84%
ethyl 3,4-dichl... CAS#:74840-06-5 |
| Literature: Tong, Y. C. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 381 - 382 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| ethyl 5,6-dichloro-1H-imidazo<4,5-b>pyrazine-2-carboxylate |