(2S,3R)-3-AMINOBUTAN-2-OL structure
|
Common Name | (2S,3R)-3-AMINOBUTAN-2-OL | ||
|---|---|---|---|---|
| CAS Number | 74839-83-1 | Molecular Weight | 398.49400 | |
| Density | 1.273g/cm3 | Boiling Point | 550.2ºC at 760 mmHg | |
| Molecular Formula | C18H22O6S2 | Melting Point | 67-69ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 286.5ºC | |
| Name | (2s,3s)-(-)-2,3-butanediol di-p-tosylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 550.2ºC at 760 mmHg |
| Melting Point | 67-69ºC(lit.) |
| Molecular Formula | C18H22O6S2 |
| Molecular Weight | 398.49400 |
| Flash Point | 286.5ºC |
| Exact Mass | 398.08600 |
| PSA | 103.50000 |
| LogP | 5.35280 |
| Index of Refraction | 1.554 |
| InChIKey | MFRBMNNZDFDJOF-HOTGVXAUSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)C(C)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| MFCD00010332 |