bis(trimethylsilyl)tributyltinphosphate structure
|
Common Name | bis(trimethylsilyl)tributyltinphosphate | ||
|---|---|---|---|---|
| CAS Number | 74785-85-6 | Molecular Weight | 531.39300 | |
| Density | N/A | Boiling Point | 423.7ºC at 760 mmHg | |
| Molecular Formula | C18H45O4PSi2Sn | Melting Point | N/A | |
| MSDS | USA | Flash Point | >230 °F | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | tributylstannyl bis(trimethylsilyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 423.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H45O4PSi2Sn |
| Molecular Weight | 531.39300 |
| Flash Point | >230 °F |
| Exact Mass | 532.16200 |
| PSA | 54.57000 |
| LogP | 8.15990 |
| InChIKey | ASQKAZSYRUOBEU-UHFFFAOYSA-M |
| SMILES | CCCC[Sn](CCCC)(CCCC)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| Storage condition | 2-8°C |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | 21-25-36/38-48/23/25-50/53 |
| Safety Phrases | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~%
bis(trimethylsi... CAS#:74785-85-6 |
| Literature: Journal of the American Chemical Society, , vol. 102, # 13 p. 4534 - 4536 |
|
Aldrichimica Acta 17 , 75, (1984)
|
| MFCD00010347 |
| 3,5-Dioxa-4-phospha-2-sila-6-stannadecane,6,6-dibutyl-2,2-dimethyl-4-[(trimethylsilyl)oxy]-,4-oxide (9CI) |
| Bis[(trimethylsilyl)tributyl]stannyl phosphate |
| tri-n-butylstannyl bis(trimethylsilyl)phosphate |