3,4-dimethyl-6-(3,4,5-trimethoxyphenyl)cyclohex-3-ene-1-carboxylic acid
Modify Date: 2025-08-29 19:11:34
3,4-dimethyl-6-(3,4,5-trimethoxyphenyl)cyclohex-3-ene-1-carboxylic acid structure
|
Common Name | 3,4-dimethyl-6-(3,4,5-trimethoxyphenyl)cyclohex-3-ene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7478-46-8 | Molecular Weight | 320.38000 | |
| Density | 1.127g/cm3 | Boiling Point | 446.8ºC at 760 mmHg | |
| Molecular Formula | C18H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.2ºC | |
| Name | 3,4-dimethyl-6-(3,4,5-trimethoxyphenyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760 mmHg |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38000 |
| Flash Point | 155.2ºC |
| Exact Mass | 320.16200 |
| PSA | 64.99000 |
| LogP | 3.62700 |
| Index of Refraction | 1.526 |
| InChIKey | QKGPVQNLHHPWQV-UHFFFAOYSA-N |
| SMILES | COc1cc(C2CC(C)=C(C)CC2C(=O)O)cc(OC)c1OC |
|
~%
3,4-dimethyl-6-... CAS#:7478-46-8 |
| Literature: Perun,T.J. et al. Journal of Organic Chemistry, 1963 , vol. 28, # 11 p. 2937 - 2943 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4.5-Dimethyl-2-<3,4,5-trimethoxy-phenyl>-cyclohexen-(4)-carbonsaeure |