9-(hydroxymethyl)fluorene-9-carboxylic acid structure
|
Common Name | 9-(hydroxymethyl)fluorene-9-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7471-93-4 | Molecular Weight | 240.25400 | |
| Density | 1.352g/cm3 | Boiling Point | 362.8ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4ºC | |
| Name | 9-(hydroxymethyl)fluorene-9-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 362.8ºC at 760 mmHg |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 187.4ºC |
| Exact Mass | 240.07900 |
| PSA | 57.53000 |
| LogP | 2.03000 |
| Index of Refraction | 1.666 |
| InChIKey | VXHRGIDXAAEBJP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(CO)c2ccccc2-c2ccccc21 |
|
~%
9-(hydroxymethy... CAS#:7471-93-4 |
| Literature: Stevens; Winch Journal of the American Chemical Society, 1959 , vol. 81, p. 1172,1175 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 9-hydroxymethyl-fluorene-9-carboxylic acid |
| 9-Hydroxymethyl-fluoren-9-carbonsaeure |