9-hydroxy-9H-fluorene-9-carboxylic acid, compound with dimethylamine (1:1) structure
|
Common Name | 9-hydroxy-9H-fluorene-9-carboxylic acid, compound with dimethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 10532-56-6 | Molecular Weight | 271.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-hydroxyfluorene-9-carboxylic acid,N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO3 |
|---|---|
| Molecular Weight | 271.31100 |
| Exact Mass | 271.12100 |
| PSA | 69.56000 |
| LogP | 2.21400 |
| InChIKey | DDJXSWMTBYWCBR-UHFFFAOYSA-N |
| SMILES | CNC.O=C(O)C1(O)c2ccccc2-c2ccccc21 |
| einecs 234-095-7 |