propyl 2,4-dimethyl-6-oxo-pyran-3-carboxylate
Modify Date: 2025-09-14 17:23:36
propyl 2,4-dimethyl-6-oxo-pyran-3-carboxylate structure
|
Common Name | propyl 2,4-dimethyl-6-oxo-pyran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7470-47-5 | Molecular Weight | 210.22600 | |
| Density | 1.135g/cm3 | Boiling Point | 310.7ºC at 760 mmHg | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | propyl 2,4-dimethyl-6-oxopyran-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 310.7ºC at 760 mmHg |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.22600 |
| Flash Point | 152.4ºC |
| Exact Mass | 210.08900 |
| PSA | 56.51000 |
| LogP | 1.82340 |
| Index of Refraction | 1.49 |
| InChIKey | QRUNYUVTFYIPPQ-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)c1c(C)cc(=O)oc1C |
| HS Code | 2932209090 |
|---|
|
~%
propyl 2,4-dime... CAS#:7470-47-5 |
| Literature: Wiley et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 244 |
|
~%
propyl 2,4-dime... CAS#:7470-47-5 |
| Literature: Wiley et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 244 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| PROPYL 2,4-DIMETHYL-6-OXO-PYRAN-3-CARBOXYLATE |
| 2,4-dimethyl-6-oxo-6H-pyran-3-carboxylic acid propyl ester |
| 2,4-Dimethyl-6-oxo-6H-pyran-3-carbonsaeure-propylester |
| propyl 4,6-dimethyl-2-oxopyran-5-carboxylate |