2,4-dimethyl-6-oxo-N-phenylpyran-3-carboxamide
Modify Date: 2025-12-01 16:21:26
2,4-dimethyl-6-oxo-N-phenylpyran-3-carboxamide structure
|
Common Name | 2,4-dimethyl-6-oxo-N-phenylpyran-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 61444-67-5 | Molecular Weight | 243.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dimethyl-6-oxo-N-phenylpyran-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO3 |
|---|---|
| Molecular Weight | 243.25800 |
| Exact Mass | 243.09000 |
| PSA | 62.80000 |
| LogP | 2.89290 |
| InChIKey | GCGOEIALGCIXAB-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc(C)c1C(=O)Nc1ccccc1 |
|
~%
2,4-dimethyl-6-... CAS#:61444-67-5 |
| Literature: Wiley et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 4931 |
| 2,4-dimethyl-6-oxo-6H-pyran-3-carboxylic acid anilide |
| 2H-Pyran-5-carboxamide,4,6-dimethyl-2-oxo-N-phenyl |
| 2,4-Dimethyl-6-oxo-6H-pyran-3-carbonsaeure-anilid |