7-methyl-5-azoniaspiro[4.5]decane structure
|
Common Name | 7-methyl-5-azoniaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 7470-32-8 | Molecular Weight | 234.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-methyl-5-azoniaspiro[4.5]decane,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H20BrN |
|---|---|
| Molecular Weight | 234.17600 |
| Exact Mass | 233.07800 |
| InChIKey | CVAHQLQBXLYNDB-UHFFFAOYSA-M |
| SMILES | CC1CCC[N+]2(CCCC2)C1.[Br-] |
|
~%
7-methyl-5-azon... CAS#:7470-32-8 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 5099,5100 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-methyl-5-azonia-spiro[4.5]decane,bromide |
| 7-Methyl-5-azonia-spiro[4.5]decan,Bromid |