8-oxa-5-azoniaspiro[4.5]decane,bromide structure
|
Common Name | 8-oxa-5-azoniaspiro[4.5]decane,bromide | ||
|---|---|---|---|---|
| CAS Number | 72562-26-6 | Molecular Weight | 222.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-oxa-5-azoniaspiro[4.5]decane,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H16BrNO |
|---|---|
| Molecular Weight | 222.12300 |
| Exact Mass | 221.04200 |
| PSA | 9.23000 |
| InChIKey | RLUREQPKEQJWFZ-UHFFFAOYSA-M |
| SMILES | C1CC[N+]2(C1)CCOCC2.[Br-] |
|
~%
8-oxa-5-azonias... CAS#:72562-26-6 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 5099,5100 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Spiro-morpholin-4,1'-pyrrolidinium-bromid |
| 8-oxa-5-azonia-spiro[4.5]decane,bromide |
| 8-Oxa-5-azonia-spiro[4.5]decan,Bromid |