N-(4 5-DIHYDRO-5-OXO-1-PHENYL-1H-PYRAZO& structure
|
Common Name | N-(4 5-DIHYDRO-5-OXO-1-PHENYL-1H-PYRAZO& | ||
|---|---|---|---|---|
| CAS Number | 74677-80-8 | Molecular Weight | 439.633 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C27H41N3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(4,5-Dihydro-5-oxo-1-phenyl-1H-pyrazol-3-yl)-9-octadecenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Molecular Formula | C27H41N3O2 |
| Molecular Weight | 439.633 |
| Exact Mass | 439.319885 |
| LogP | 7.86 |
| Index of Refraction | 1.543 |
| InChIKey | KIZIRRWZTGNUCT-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC1=NN(c2ccccc2)C(=O)C1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| (9Z)-N-(5-Oxo-1-phenyl-4,5-dihydro-1H-pyrazol-3-yl)-9-octadecenamide |
| 9-Octadecenamide, N-(4,5-dihydro-5-oxo-1-phenyl-1H-pyrazol-3-yl)-, (9Z)- |
| MFCD00142685 |