Benzenepropanol,2,3-dimethoxy-, 1-(N-phenylcarbamate) structure
|
Common Name | Benzenepropanol,2,3-dimethoxy-, 1-(N-phenylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 7461-68-9 | Molecular Weight | 315.36400 | |
| Density | 1.165g/cm3 | Boiling Point | 415ºC at 760mmHg | |
| Molecular Formula | C18H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate |
|---|
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 415ºC at 760mmHg |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.36400 |
| Flash Point | 204.8ºC |
| Exact Mass | 315.14700 |
| PSA | 56.79000 |
| LogP | 3.95810 |
| Index of Refraction | 1.574 |
| InChIKey | QNWODVLGOHFVNV-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCCOC(=O)Nc2ccccc2)c1OC |
|
~%
Benzenepropanol... CAS#:7461-68-9 |
| Literature: Mason Journal of the American Chemical Society, 1947 , vol. 69, p. 2241 |
|
~%
Benzenepropanol... CAS#:7461-68-9 |
| Literature: Mason Journal of the American Chemical Society, 1947 , vol. 69, p. 2241 |
|
~%
Benzenepropanol... CAS#:7461-68-9 |
| Literature: Mason Journal of the American Chemical Society, 1947 , vol. 69, p. 2241 |