Cristacarpin structure
|
Common Name | Cristacarpin | ||
|---|---|---|---|---|
| CAS Number | 74515-47-2 | Molecular Weight | 354.40 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 518.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.1±30.1 °C | |
Use of CristacarpinCristacarpin can be extracted from the stem bark of Erythrina suberosa, promotes endoplasmic reticulum (ER) stress, leading to sublethal reactive oxygen species (ROS) production and ultimately cell death through senescence[1]. |
| Name | Cristacarpin |
|---|---|
| Synonym | More Synonyms |
| Description | Cristacarpin can be extracted from the stem bark of Erythrina suberosa, promotes endoplasmic reticulum (ER) stress, leading to sublethal reactive oxygen species (ROS) production and ultimately cell death through senescence[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 518.1±50.0 °C at 760 mmHg |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 |
| Flash Point | 267.1±30.1 °C |
| Exact Mass | 354.146729 |
| PSA | 68.15000 |
| LogP | 3.74 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | ZHPYEBFYLDGZKF-LEWJYISDSA-N |
| SMILES | COc1ccc2c(c1CC=C(C)C)OC1c3ccc(O)cc3OCC21O |
| Hazard Codes | Xi |
|---|
| Cristacarpin |
| (6aS,11aS)-9-Methoxy-10-(3-methyl-2-buten-1-yl)-6H-[1]benzofuro[3,2-c]chromene-3,6a(11aH)-diol |
| 6H-Benzofuro[3,2-c][1]benzopyran-3,6a(11aH)-diol, 9-methoxy-10-(3-methyl-2-buten-1-yl)-, (6aS,11aS)- |
| 6H-Benzofuro(3,2-c)(1)benzopyran-3,6a(11aH)-diol, 9-methoxy-10-(3-methyl-2-butenyl)-, (6aS-cis)- |