BIS(PENTAMETHYLCYCLOPENTADIENYL)MAGNESIUM structure
|
Common Name | BIS(PENTAMETHYLCYCLOPENTADIENYL)MAGNESIUM | ||
|---|---|---|---|---|
| CAS Number | 74507-64-5 | Molecular Weight | 294.75700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30Mg | Melting Point | 230ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS02 |
Signal Word | Danger | |
| Name | magnesium,1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 230ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C20H30Mg |
| Molecular Weight | 294.75700 |
| Exact Mass | 294.22000 |
| LogP | 5.94400 |
| InChIKey | QZNMZKZCVOJICG-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.Cc1c(C)c(C)[c-](C)c1C.[Mg+2] |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H250 |
| Precautionary Statements | P222-P231-P422 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves |
| Hazard Codes | F: Flammable; |
| Risk Phrases | 17 |
| Safety Phrases | 16-36/37/39-26 |
| RIDADR | UN 2845 |
| Packaging Group | II |
| Hazard Class | 4.1 |
| HS Code | 2931900090 |
|
~%
BIS(PENTAMETHYL... CAS#:74507-64-5 |
| Literature: Journal of the American Chemical Society, , vol. 104, p. 1882 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| decamethylmagnesocene |
| 1,2,3,4,5-pentamethylcyclopentane |
| Magnesocene,decamethyl |
| 1,3-Cyclopentadiene,1,2,3,4,5-pentamethyl-,magnesium complex |
| MFCD00151387 |