3,4-Dichloro-6-trifluoromethyltoluene structure
|
Common Name | 3,4-Dichloro-6-trifluoromethyltoluene | ||
|---|---|---|---|---|
| CAS Number | 74483-51-5 | Molecular Weight | 229.027 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 201.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5Cl2F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.3±19.4 °C | |
| Name | 1,2-Dichloro-4-methyl-5-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 201.5±35.0 °C at 760 mmHg |
| Molecular Formula | C8H5Cl2F3 |
| Molecular Weight | 229.027 |
| Flash Point | 88.3±19.4 °C |
| Exact Mass | 227.972046 |
| LogP | 4.58 |
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | OARYHYOOIUIKFZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c(Cl)cc1C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903999090 |
|
~76%
3,4-Dichloro-6-... CAS#:74483-51-5 |
| Literature: Bayer Aktiengesellschaft Patent: US4533777 A1, 1985 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD06246858 |
| 1,2-Dichlor-4-methyl-5-(trifluormethyl)benzol |
| 1,2-Dichloro-4-methyl-5-(trifluoromethyl)benzene |
| Benzene, 1,2-dichloro-4-methyl-5-(trifluoromethyl)- |
| 3,4-Dichloro-6-trifluoromethyltoluene |