p-Aminobenzoyl Benzamide structure
|
Common Name | p-Aminobenzoyl Benzamide | ||
|---|---|---|---|---|
| CAS Number | 74441-06-8 | Molecular Weight | 255.27200 | |
| Density | 1.348 g/cm3 | Boiling Point | 432.5ºC at 760 mmHg | |
| Molecular Formula | C14H13N3O2 | Melting Point | 319°C | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | p-Aminobenzoyl Benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348 g/cm3 |
|---|---|
| Boiling Point | 432.5ºC at 760 mmHg |
| Melting Point | 319°C |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.27200 |
| Flash Point | 215.4ºC |
| Exact Mass | 255.10100 |
| PSA | 98.21000 |
| LogP | 2.97450 |
| Index of Refraction | 1.71 |
| InChIKey | FSPYMSUDIVFOHY-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(NC(=O)c2ccc(N)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Aminobenzoyl benzamide |
| EINECS 277-874-7 |