3-(4-phosphonocarbonyloxyphenyl)propanoic acid
Modify Date: 2025-09-18 16:01:26
3-(4-phosphonocarbonyloxyphenyl)propanoic acid structure
|
Common Name | 3-(4-phosphonocarbonyloxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 74270-35-2 | Molecular Weight | 274.16400 | |
| Density | 1.578g/cm3 | Boiling Point | 534.2ºC at 760 mmHg | |
| Molecular Formula | C10H11O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.8ºC | |
| Name | 3-(4-phosphonocarbonyloxyphenyl)propanoic acid |
|---|
| Density | 1.578g/cm3 |
|---|---|
| Boiling Point | 534.2ºC at 760 mmHg |
| Molecular Formula | C10H11O7P |
| Molecular Weight | 274.16400 |
| Flash Point | 276.8ºC |
| Exact Mass | 274.02400 |
| PSA | 130.94000 |
| LogP | 1.38030 |
| Index of Refraction | 1.59 |
| InChIKey | HKLBKQAYLOPZMV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(OC(=O)P(=O)(O)O)cc1 |
|
~21%
3-(4-phosphonoc... CAS#:74270-35-2 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~%
3-(4-phosphonoc... CAS#:74270-35-2 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~%
3-(4-phosphonoc... CAS#:74270-35-2 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |