3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid
3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid structure
|
Common Name | 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 72304-77-9 | Molecular Weight | 330.27000 | |
| Density | 1.283g/cm3 | Boiling Point | 446.4ºC at 760 mmHg | |
| Molecular Formula | C14H19O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 446.4ºC at 760 mmHg |
| Molecular Formula | C14H19O7P |
| Molecular Weight | 330.27000 |
| Flash Point | 223.8ºC |
| Exact Mass | 330.08700 |
| PSA | 108.94000 |
| LogP | 3.46870 |
| Index of Refraction | 1.514 |
| InChIKey | WJLKJPJNDKUQTC-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(=O)Oc1ccc(CCC(=O)O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~88%
3-(4-diethoxyph... CAS#:72304-77-9 |
| Literature: Astra Lakemedel Aktiebolag Patent: US4372894 A1, 1983 ; US 4372894 A |
|
~%
3-(4-diethoxyph... CAS#:72304-77-9 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~86%
3-(4-diethoxyph... CAS#:72304-77-9 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:74270-35-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Diethyl 4-(ethoxycarbonyl)phenoxycarbonylphosphonate |
| Benzenepropanoic acid,4-(((diethoxyphosphinyl)carbonyl)oxy) |
| diethyl p-(ethoxycarbonyl)phenoxycarbonylphosphonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: LogP of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid is 3.46870. |
| Q: What English synonyms does 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid have? |
| A: English synonyms of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid: Diethyl 4-(ethoxycarbonyl)phenoxycarbonylphosphonate, Benzenepropanoic acid,4-(((diethoxyphosphinyl)carbonyl)oxy), diethyl p-(ethoxycarbonyl)phenoxycarbonylphosphonate. |
| Q: What is the molecular weight of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: Molecular weight of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid is 330.27000. |
| Q: What is the CAS number of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: CAS number of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid is 72304-77-9. |
| Q: What are the upstream materials of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: Related upstream materials(CAS) of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid: 72305-25-0;120-47-8;122-52-1. |
| Q: What is the InChIKey of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: InChIKey of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid is WJLKJPJNDKUQTC-UHFFFAOYSA-N. |
| Q: What are the downstream products of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: Related downstream products(CAS) of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid: 74270-35-2. |
| Q: What is the polar surface area (PSA) of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: Polar surface area (PSA) of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid is 108.94000. |
| Q: What is the boiling point of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid? |
| A: Boiling point of 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid is 446.4ºC at 760 mmHg. |
| Q: What is the Chinese name of 72304-77-9? |
| A: Chinese name of 72304-77-9 is 72304-77-9. |