1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole structure
|
Common Name | 1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole | ||
|---|---|---|---|---|
| CAS Number | 74257-00-4 | Molecular Weight | 296.302 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 533.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C11H12N4O4S | Melting Point | 134-139 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 276.4±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(Mesitylene-2-sulfonyl)-3-nitro-1,2,4-triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 533.4±60.0 °C at 760 mmHg |
| Melting Point | 134-139 °C(lit.) |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.302 |
| Flash Point | 276.4±32.9 °C |
| Exact Mass | 296.057922 |
| PSA | 119.05000 |
| LogP | 2.08 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | SFYDWLYPIXHPML-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cnc([N+](=O)[O-])n2)c(C)c1 |
| Storage condition | −20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
1-(Mesitylsulfo... CAS#:74257-00-4 |
| Literature: Tetrahedron Letters, , vol. 27, # 45 p. 5529 - 5532 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-1,2,4-Triazole, 3-nitro-1-[(2,4,6-trimethylphenyl)sulfonyl]- |
| 1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole |
| 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole |
| MFCD00009754 |