4-[4-(4-hydroxyphenyl)heptan-4-yl]phenol structure
|
Common Name | 4-[4-(4-hydroxyphenyl)heptan-4-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 7425-79-8 | Molecular Weight | 284.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-(4-hydroxyphenyl)heptan-4-yl]phenol |
|---|
| Molecular Formula | C19H24O2 |
|---|---|
| Molecular Weight | 284.39300 |
| Exact Mass | 284.17800 |
| PSA | 40.46000 |
| LogP | 4.98410 |
| InChIKey | MLDIQALUMKMHCC-UHFFFAOYSA-N |
| SMILES | CCCC(CCC)(c1ccc(O)cc1)c1ccc(O)cc1 |
|
~%
4-[4-(4-hydroxy... CAS#:7425-79-8 |
| Literature: Reid; Wilson Journal of the American Chemical Society, 1944 , vol. 66, p. 967 |
|
~%
4-[4-(4-hydroxy... CAS#:7425-79-8 |
| Literature: Reid; Wilson Journal of the American Chemical Society, 1944 , vol. 66, p. 967 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |