2-dimethoxyphosphoryl-N-phenyl-adamantan-2-amine structure
|
Common Name | 2-dimethoxyphosphoryl-N-phenyl-adamantan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 74189-80-3 | Molecular Weight | 335.37800 | |
| Density | 1.2g/cm3 | Boiling Point | 471.7ºC at 760 mmHg | |
| Molecular Formula | C18H26NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1ºC | |
| Name | 2-dimethoxyphosphoryl-N-phenyladamantan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 471.7ºC at 760 mmHg |
| Molecular Formula | C18H26NO3P |
| Molecular Weight | 335.37800 |
| Flash Point | 239.1ºC |
| Exact Mass | 335.16500 |
| PSA | 57.37000 |
| LogP | 4.80980 |
| Index of Refraction | 1.558 |
| InChIKey | JWUZANLTBUJUOR-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C1(Nc2ccccc2)C2CC3CC(C2)CC1C3 |
|
~%
2-dimethoxyphos... CAS#:74189-80-3 |
| Literature: Buchanan, Gerald W.; Morin, Frederick G. Canadian Journal of Chemistry, 1980 , vol. 58, p. 530 - 536 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-dimethylphosphono-1-phenylaminoadamantane |