2-Anilino-5-nitrothiazole structure
|
Common Name | 2-Anilino-5-nitrothiazole | ||
|---|---|---|---|---|
| CAS Number | 21166-17-6 | Molecular Weight | 221.23600 | |
| Density | 1.474g/cm3 | Boiling Point | 389.3ºC at 760 mmHg | |
| Molecular Formula | C9H7N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.3ºC | |
| Name | 5-nitro-N-phenyl-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.474g/cm3 |
|---|---|
| Boiling Point | 389.3ºC at 760 mmHg |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.23600 |
| Flash Point | 189.3ºC |
| Exact Mass | 221.02600 |
| PSA | 98.98000 |
| LogP | 3.39110 |
| Vapour Pressure | 2.87E-06mmHg at 25°C |
| Index of Refraction | 1.71 |
| InChIKey | WAXMJNXACVJJDH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccccc2)s1 |
| HS Code | 2934100090 |
|---|
|
~%
2-Anilino-5-nit... CAS#:21166-17-6 |
| Literature: Ilvespaeae,A.O. Helvetica Chimica Acta, 1968 , vol. 51, p. 1723 - 1733 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Thiazole,2-anilino-5-nitro |
| 2-Anilino-5-nitrothiazole |