2-(Di-tert-butylphosphino)-1-phenylindole structure
|
Common Name | 2-(Di-tert-butylphosphino)-1-phenylindole | ||
|---|---|---|---|---|
| CAS Number | 740815-37-6 | Molecular Weight | 337.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28NP | Melting Point | 90-92℃ (methanol ) | |
| MSDS | USA | Flash Point | N/A | |
| Name | ditert-butyl-(1-phenylindol-2-yl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 90-92℃ (methanol ) |
|---|---|
| Molecular Formula | C22H28NP |
| Molecular Weight | 337.43800 |
| Exact Mass | 337.19600 |
| PSA | 18.52000 |
| LogP | 6.33470 |
| Appearance of Characters | Powder | white to yellow |
| InChIKey | HDZRDZCQFYUOHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(c1cc2ccccc2n1-c1ccccc1)C(C)(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| N-Phenylindol-2-yl-di-tert-butylphosphine |