2-(Di-tert-butylphosphino)-2',6'-dimethylbiphenyl
Modify Date: 2025-09-22 16:09:09
2-(Di-tert-butylphosphino)-2',6'-dimethylbiphenyl structure
|
Common Name | 2-(Di-tert-butylphosphino)-2',6'-dimethylbiphenyl | ||
|---|---|---|---|---|
| CAS Number | 298205-47-7 | Molecular Weight | 326.45500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H31P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2',6'-Dimethyl-2-biphenylyl)[bis(2-methyl-2-propanyl)]phosphine |
|---|
| Molecular Formula | C22H31P |
|---|---|
| Molecular Weight | 326.45500 |
| Exact Mass | 326.21600 |
| PSA | 13.59000 |
| LogP | 6.67460 |
| InChIKey | BKSBWMABBLBKKW-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1-c1ccccc1P(C(C)(C)C)C(C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |