2-methyl-5-(3-nitrophenyl)-1,3-oxazole structure
|
Common Name | 2-methyl-5-(3-nitrophenyl)-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 74048-11-6 | Molecular Weight | 204.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-5-(3-nitrophenyl)-1,3-oxazole |
|---|
| Molecular Formula | C10H8N2O3 |
|---|---|
| Molecular Weight | 204.18200 |
| Exact Mass | 204.05300 |
| PSA | 71.85000 |
| LogP | 3.08140 |
| InChIKey | NKWSLJOPYDWQBF-UHFFFAOYSA-N |
| SMILES | Cc1ncc(-c2cccc([N+](=O)[O-])c2)o1 |
|
~%
2-methyl-5-(3-n... CAS#:74048-11-6 |
| Literature: Ibata,T.; Sato,R. Bulletin of the Chemical Society of Japan, 1979 , vol. 52, p. 3597 - 3600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |