2-methyl-2-(3-nitrophenyl)-1,3-dioxolane structure
|
Common Name | 2-methyl-2-(3-nitrophenyl)-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 51226-13-2 | Molecular Weight | 209.19900 | |
| Density | 1.265g/cm3 | Boiling Point | 317.6ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.1ºC | |
| Name | 2-methyl-2-(3-nitrophenyl)-1,3-dioxolane |
|---|
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 317.6ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 145.1ºC |
| Exact Mass | 209.06900 |
| PSA | 64.28000 |
| LogP | 2.33750 |
| Index of Refraction | 1.55 |
| InChIKey | GMSSLCFXSWWJOF-UHFFFAOYSA-N |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)OCCO1 |
|
~91%
2-methyl-2-(3-n... CAS#:51226-13-2 |
| Literature: Petersen, Lars; Jensen, Knud J.; Nielsen, John Synthesis, 1999 , # 10 p. 1763 - 1766 |
|
~%
2-methyl-2-(3-n... CAS#:51226-13-2 |
| Literature: Suzuki, Hitomi; Yonezawa, Shuji; Mori, Tadashi Bulletin of the Chemical Society of Japan, 1995 , vol. 68, # 6 p. 1535 - 1544 |
|
~%
2-methyl-2-(3-n... CAS#:51226-13-2 |
| Literature: Suzuki, Hitomi; Yonezawa, Shuji; Mori, Tadashi Bulletin of the Chemical Society of Japan, 1995 , vol. 68, # 6 p. 1535 - 1544 |