4-amino-N-(6-methoxyquinolin-8-yl)benzenesulfonamide structure
|
Common Name | 4-amino-N-(6-methoxyquinolin-8-yl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7404-14-0 | Molecular Weight | 329.37400 | |
| Density | 1.418g/cm3 | Boiling Point | 569.2ºC at 760 mmHg | |
| Molecular Formula | C16H15N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.1ºC | |
| Name | 4-amino-N-(6-methoxyquinolin-8-yl)benzenesulfonamide |
|---|
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 569.2ºC at 760 mmHg |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.37400 |
| Flash Point | 298.1ºC |
| Exact Mass | 329.08300 |
| PSA | 102.69000 |
| LogP | 4.36140 |
| Index of Refraction | 1.695 |
| InChIKey | UOVHJIRVCJUADM-UHFFFAOYSA-N |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(N)cc2)c2ncccc2c1 |
|
~%
4-amino-N-(6-me... CAS#:7404-14-0 |
| Literature: Choudhury; Das-Gupta; Basu Journal of the Indian Chemical Society, 1937 , vol. 14, p. 733 |
|
~%
4-amino-N-(6-me... CAS#:7404-14-0 |
| Literature: Choudhury; Das-Gupta; Basu Journal of the Indian Chemical Society, 1937 , vol. 14, p. 733 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |