methyl 2-hydroxy-5-[6-(4-hydroxy-3-methoxycarbonyl-phenoxy)hexa-2,4-diynoxy]benzoate
Modify Date: 2025-08-25 19:38:29
![methyl 2-hydroxy-5-[6-(4-hydroxy-3-methoxycarbonyl-phenoxy)hexa-2,4-diynoxy]benzoate Structure](https://image.chemsrc.com/caspic/264/73922-95-9.png)
methyl 2-hydroxy-5-[6-(4-hydroxy-3-methoxycarbonyl-phenoxy)hexa-2,4-diynoxy]benzoate structure
|
Common Name | methyl 2-hydroxy-5-[6-(4-hydroxy-3-methoxycarbonyl-phenoxy)hexa-2,4-diynoxy]benzoate | ||
|---|---|---|---|---|
| CAS Number | 73922-95-9 | Molecular Weight | 410.37400 | |
| Density | 1.351g/cm3 | Boiling Point | 619.3ºC at 760 mmHg | |
| Molecular Formula | C22H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | methyl 2-hydroxy-5-[6-(4-hydroxy-3-methoxycarbonylphenoxy)hexa-2,4-diynoxy]benzoate |
|---|
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 619.3ºC at 760 mmHg |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.37400 |
| Flash Point | 216.2ºC |
| Exact Mass | 410.10000 |
| PSA | 111.52000 |
| LogP | 2.13560 |
| Index of Refraction | 1.612 |
| InChIKey | JWGACPRKWULBJX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OCC#CC#CCOc2ccc(O)c(C(=O)OC)c2)ccc1O |
|
~87%
methyl 2-hydrox... CAS#:73922-95-9 |
| Literature: Jarvi, E. T.; Whitlock, H. W. Journal of the American Chemical Society, 1980 , vol. 102, # 2 p. 657 - 662 |
|
~%
methyl 2-hydrox... CAS#:73922-95-9 |
| Literature: Jarvi, E. T.; Whitlock, H. W. Journal of the American Chemical Society, 1980 , vol. 102, # 2 p. 657 - 662 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:73922-97-1