Acanthoside B structure
|
Common Name | Acanthoside B | ||
|---|---|---|---|---|
| CAS Number | 7374-79-0 | Molecular Weight | 580.578 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 778.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C28H36O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 424.6±32.9 °C | |
Use of Acanthoside BAcanthoside B is a potential bioactive lignan with anti-inflammatory and anti-amnesic activities. Acanthoside B can be used for alzheimer's disease and lung inflammation research[1] |
| Name | (+)-syringaresinol β-D-glucoside |
|---|---|
| Synonym | More Synonyms |
| Description | Acanthoside B is a potential bioactive lignan with anti-inflammatory and anti-amnesic activities. Acanthoside B can be used for alzheimer's disease and lung inflammation research[1] |
|---|---|
| Related Catalog | |
| In Vivo | Acanthoside B (oral gavage; 10-20 mg/kg; 7 days prior to Scopolamine injection) attenuates Scopolamine inflicted AD-like amnesic traits by restoring the cholinergic activity, decreasing the endogenous antioxidant status, suppressing neuroinflammation, and activating the TrkB/CREB/BDNF pathway in mice[1]. Animal Model: Scopolamine-induced amnesic mouse model[1] Dosage: 10 mg/kg; 20 mg/kg Administration: oral gavage; 7 days Result: Exhibited an anti-amnesic effect in mice. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 778.5±60.0 °C at 760 mmHg |
| Molecular Formula | C28H36O13 |
| Molecular Weight | 580.578 |
| Flash Point | 424.6±32.9 °C |
| Exact Mass | 580.215576 |
| PSA | 174.99000 |
| LogP | -1.60 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | WEKCEGQSIIQPAQ-IRBNZIFYSA-N |
| SMILES | COc1cc(C2OCC3C(c4cc(OC)c(OC5OC(CO)C(O)C(O)C5O)c(OC)c4)OCC23)cc(OC)c1O |
| HS Code | 1302199099 |
|---|
|
~86%
Acanthoside B CAS#:7374-79-0 |
| Literature: Vermes, Barbara; Seligmann, Otto; Wagner, Hildebert Phytochemistry (Elsevier), 1991 , vol. 30, # 9 p. 3087 - 3090 |
|
~%
Acanthoside B CAS#:7374-79-0 |
| Literature: Phytochemistry (Elsevier), , vol. 30, # 9 p. 3087 - 3090 |
|
~%
Acanthoside B CAS#:7374-79-0 |
| Literature: Phytochemistry (Elsevier), , vol. 30, # 9 p. 3087 - 3090 |
|
~%
Acanthoside B CAS#:7374-79-0 |
| Literature: Phytochemistry (Elsevier), , vol. 30, # 9 p. 3087 - 3090 |
| HS Code | 1302199099 |
|---|
| (+)-syringaresinol beta-D-glucoside |
| acanthoside B |
| ELEUTHEROSIDE B+E |
| ELEUTHEROSIDE E1 |