1-Benzyl-5-ethyl-5-isopentylbarbituric acid
Modify Date: 2025-09-21 12:18:35
1-Benzyl-5-ethyl-5-isopentylbarbituric acid structure
|
Common Name | 1-Benzyl-5-ethyl-5-isopentylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 73680-98-5 | Molecular Weight | 316.39500 | |
| Density | 1.11g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzyl-5-ethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.39500 |
| Exact Mass | 316.17900 |
| PSA | 69.97000 |
| LogP | 3.31140 |
| Index of Refraction | 1.525 |
| InChIKey | JNFAJTHZJGSFSA-UHFFFAOYSA-N |
| SMILES | CCC1(CCC(C)C)C(=O)NC(=O)N(Cc2ccccc2)C1=O |
|
~%
1-Benzyl-5-ethy... CAS#:73680-98-5 |
| Literature: Dox; Jones Journal of the American Chemical Society, 1929 , vol. 51, p. 317 |
|
~%
1-Benzyl-5-ethy... CAS#:73680-98-5 |
| Literature: Ardis et al. Journal of the American Chemical Society, 1942 , vol. 64, p. 2514 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 5-ethyl-5-(3-methylbutyl)-1-(phenylmethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione |
| 5-ethyl-1-benzyl-5-isopentyl-barbituric acid |
| N-Benzyl-amobarbital |
| 1-Benzyl-5-ethyl-5-isopentyl barbituric acid |
| 1-benzyl-5-ethyl-5-(3-methyl-butyl)-pyrimidine-2,4,6-trione |
| 1-Benzyl-5-ethyl-5-isoamyl barbituric acid |
| 5-Aethyl-1-benzyl-5-isopentyl-barbitursaeure |
| BARBITURIC ACID,1-BENZYL-5-ETHYL-5-ISOPENTYL |